C11H21NO2 — CID 79495899
1,1-diethoxy-N-propylbut-3-yn-2-amine (PubChem CID 79495899) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1,1-diethoxy-N-propylbut-3-yn-2-amine.
| Compound Name | 1,1-diethoxy-N-propylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 79495899 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1,1-diethoxy-N-propylbut-3-yn-2-amine |
| SMILES | C#CC(NCCC)C(OCC)OCC |
| InChI | InChI=1S/C11H21NO2/c1-5-9-12-10(6-2)11(13-7-3)14-8-4/h2,10-12H,5,7-9H2,1,3-4H3 |
| InChIKey | IXZVMHRHTJNJRN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|