C10H16O2 — CID 3021755
5,5-diethoxy-4-methylpent-3-en-1-yne (PubChem CID 3021755) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5,5-diethoxy-4-methylpent-3-en-1-yne.
| Compound Name | 5,5-diethoxy-4-methylpent-3-en-1-yne |
|---|---|
| PubChem CID | 3021755 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 5,5-diethoxy-4-methylpent-3-en-1-yne |
| SMILES | C#CC=C(C)C(OCC)OCC |
| InChI | InChI=1S/C10H16O2/c1-5-8-9(4)10(11-6-2)12-7-3/h1,8,10H,6-7H2,2-4H3 |
| InChIKey | DERQCIKRSQWNOA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|