C13H22N2O — CID 79496112
N-(1,2-oxazol-3-ylmethyl)-4-propylcyclohexan-1-amine (PubChem CID 79496112) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-4-propylcyclohexan-1-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79496112 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(NCc2ccon2)CC1 |
| InChI | InChI=1S/C13H22N2O/c1-2-3-11-4-6-12(7-5-11)14-10-13-8-9-16-15-13/h8-9,11-12,14H,2-7,10H2,1H3 |
| InChIKey | ZCIRBNVRXZTVAB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |