C12H20N2O — CID 81170767
2,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine (PubChem CID 81170767) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 81170767 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1CCC(NCc2ccon2)C(C)C1 |
| InChI | InChI=1S/C12H20N2O/c1-9-3-4-12(10(2)7-9)13-8-11-5-6-15-14-11/h5-6,9-10,12-13H,3-4,7-8H2,1-2H3 |
| InChIKey | DDTONRPKZYRAAS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |