C11H11BrN2O — CID 79496120
1-(3-bromophenyl)-N-(1,2-oxazol-3-ylmethyl)methanamine (PubChem CID 79496120) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(1,2-oxazol-3-ylmethyl)methanamine.
| Compound Name | 1-(3-bromophenyl)-N-(1,2-oxazol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 79496120 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 1-(3-bromophenyl)-N-(1,2-oxazol-3-ylmethyl)methanamine |
| SMILES | Brc1cccc(CNCc2ccon2)c1 |
| InChI | InChI=1S/C11H11BrN2O/c12-10-3-1-2-9(6-10)7-13-8-11-4-5-15-14-11/h1-6,13H,7-8H2 |
| InChIKey | WSHOEVVAHYDQLY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |