C11H19N3 — CID 79496893
5-cyclopentyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 79496893) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-cyclopentyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-cyclopentyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79496893 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-cyclopentyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1C(N)=NCC1C1CCCC1 |
| InChI | InChI=1S/C11H19N3/c1-2-7-14-10(8-13-11(14)12)9-5-3-4-6-9/h2,9-10H,1,3-8H2,(H2,12,13) |
| InChIKey | LIEFSPXTFMRSRK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|