C12H21N3 — CID 79497073
5-cyclohexyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 79497073) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-cyclohexyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-cyclohexyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79497073 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 5-cyclohexyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1C(N)=NCC1C1CCCCC1 |
| InChI | InChI=1S/C12H21N3/c1-2-8-15-11(9-14-12(15)13)10-6-4-3-5-7-10/h2,10-11H,1,3-9H2,(H2,13,14) |
| InChIKey | BVFLHVDUSWVNJL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|