C11H23N3 — CID 79498006
5-pentyl-1-propan-2-yl-4,5-dihydroimidazol-2-amine (PubChem CID 79498006) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 5-pentyl-1-propan-2-yl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-pentyl-1-propan-2-yl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79498006 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 5-pentyl-1-propan-2-yl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCCC1CN=C(N)N1C(C)C |
| InChI | InChI=1S/C11H23N3/c1-4-5-6-7-10-8-13-11(12)14(10)9(2)3/h9-10H,4-8H2,1-3H3,(H2,12,13) |
| InChIKey | FUWWIIAOMDOZCH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|