C11H23N3 — CID 79514063
1-butan-2-yl-5-tert-butyl-4,5-dihydroimidazol-2-amine (PubChem CID 79514063) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-butan-2-yl-5-tert-butyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-butan-2-yl-5-tert-butyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79514063 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-butan-2-yl-5-tert-butyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCC(C)N1C(N)=NCC1C(C)(C)C |
| InChI | InChI=1S/C11H23N3/c1-6-8(2)14-9(11(3,4)5)7-13-10(14)12/h8-9H,6-7H2,1-5H3,(H2,12,13) |
| InChIKey | KKOHFNBVSAQFKA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |