C15H21F2N3O — CID 79502717
1-butan-2-yl-5-[3-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine (PubChem CID 79502717) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-butan-2-yl-5-[3-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine.
| Compound Name | 1-butan-2-yl-5-[3-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79502717 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-butan-2-yl-5-[3-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine |
| SMILES | CCC(C)N1C(N)=NCC1(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2N3O/c1-4-10(2)20-14(18)19-9-15(20,3)11-6-5-7-12(8-11)21-13(16)17/h5-8,10,13H,4,9H2,1-3H3,(H2,18,19) |
| InChIKey | LAHUQUBKPGWONG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |