C8H17N5O2S — CID 79504575
4-(aminomethyl)-5-[[methyl(propan-2-yl)sulfamoyl]amino]-1H-pyrazole (PubChem CID 79504575) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(aminomethyl)-5-[[methyl(propan-2-yl)sulfamoyl]amino]-1H-pyrazole.
| Compound Name | 4-(aminomethyl)-5-[[methyl(propan-2-yl)sulfamoyl]amino]-1H-pyrazole |
|---|---|
| PubChem CID | 79504575 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(aminomethyl)-5-[[methyl(propan-2-yl)sulfamoyl]amino]-1H-pyrazole |
| SMILES | CC(C)N(C)S(=O)(=O)Nc1[nH]ncc1CN |
| InChI | InChI=1S/C8H17N5O2S/c1-6(2)13(3)16(14,15)12-8-7(4-9)5-10-11-8/h5-6H,4,9H2,1-3H3,(H2,10,11,12) |
| InChIKey | FAKDFYPFZDCZQH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |