C10H12FN3 — CID 79510699
5-(4-fluorophenyl)-1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 79510699) has the molecular formula C10H12FN3 and a molecular weight of 193.22 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-methyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-(4-fluorophenyl)-1-methyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79510699 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 5-(4-fluorophenyl)-1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | CN1C(N)=NCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FN3/c1-14-9(6-13-10(14)12)7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3,(H2,12,13) |
| InChIKey | DBFDRIFZVMPWCO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |