C18H16O5 — CID 795115
(3Z)-5-(3,4-dimethoxyphenyl)-3-[(5-methylfuran-2-yl)methylidene]furan-2-one (PubChem CID 795115) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is (3Z)-5-(3,4-dimethoxyphenyl)-3-[(5-methylfuran-2-yl)methylidene]furan-2-one.
| Compound Name | (3Z)-5-(3,4-dimethoxyphenyl)-3-[(5-methylfuran-2-yl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 795115 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (3Z)-5-(3,4-dimethoxyphenyl)-3-[(5-methylfuran-2-yl)methylidene]furan-2-one |
| SMILES | COc1ccc(C2=C/C(=C/c3ccc(C)o3)C(=O)O2)cc1OC |
| InChI | InChI=1S/C18H16O5/c1-11-4-6-14(22-11)8-13-10-16(23-18(13)19)12-5-7-15(20-2)17(9-12)21-3/h4-10H,1-3H3/b13-8- |
| InChIKey | WXVRLRFFTNAOBF-JYRVWZFOSA-N |
| XLogP | 3.59 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|