C17H13NO7 — CID 4058017
5-(3,4-dimethoxyphenyl)-3-[(5-nitrofuran-2-yl)methylidene]furan-2-one (PubChem CID 4058017) has the molecular formula C17H13NO7 and a molecular weight of 343.29 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-[(5-nitrofuran-2-yl)methylidene]furan-2-one.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-[(5-nitrofuran-2-yl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 4058017 |
| Molecular Formula | C17H13NO7 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-[(5-nitrofuran-2-yl)methylidene]furan-2-one |
| SMILES | COc1ccc(C2=CC(=Cc3ccc([N+](=O)[O-])o3)C(=O)O2)cc1OC |
| InChI | InChI=1S/C17H13NO7/c1-22-13-5-3-10(8-15(13)23-2)14-9-11(17(19)25-14)7-12-4-6-16(24-12)18(20)21/h3-9H,1-2H3 |
| InChIKey | LVRDRMWLTHHRPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|