C13H12N2O5 — CID 71329734
N-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)methanimine (PubChem CID 71329734) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)methanimine.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)methanimine |
|---|---|
| PubChem CID | 71329734 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)methanimine |
| SMILES | COc1ccc(/N=C/c2ccc([N+](=O)[O-])o2)cc1OC |
| InChI | InChI=1S/C13H12N2O5/c1-18-11-5-3-9(7-12(11)19-2)14-8-10-4-6-13(20-10)15(16)17/h3-8H,1-2H3/b14-8+ |
| InChIKey | BMZCAUQKVZIGOK-RIYZIHGNSA-N |
| XLogP | 2.96 |
| TPSA | 87.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|