C11H17BrN4O2 — CID 79534620
N-(3-bromo-5-nitro-2-pyridinyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 79534620) has the molecular formula C11H17BrN4O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is N-(3-bromo-5-nitro-2-pyridinyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(3-bromo-5-nitro-2-pyridinyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 79534620 |
| Molecular Formula | C11H17BrN4O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(3-bromo-5-nitro-2-pyridinyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(C)CCNc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H17BrN4O2/c1-8(2)15(3)5-4-13-11-10(12)6-9(7-14-11)16(17)18/h6-8H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | FDDMVRMWTYWQBQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|