C16H24F2N2S — CID 79540761
N-[1-(azepan-2-yl)propan-2-yl]-2-(difluoromethylsulfanyl)aniline (PubChem CID 79540761) has the molecular formula C16H24F2N2S and a molecular weight of 314.44 g/mol. Its IUPAC name is N-[1-(azepan-2-yl)propan-2-yl]-2-(difluoromethylsulfanyl)aniline.
| Compound Name | N-[1-(azepan-2-yl)propan-2-yl]-2-(difluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 79540761 |
| Molecular Formula | C16H24F2N2S |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[1-(azepan-2-yl)propan-2-yl]-2-(difluoromethylsulfanyl)aniline |
| SMILES | CC(CC1CCCCCN1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C16H24F2N2S/c1-12(11-13-7-3-2-6-10-19-13)20-14-8-4-5-9-15(14)21-16(17)18/h4-5,8-9,12-13,16,19-20H,2-3,6-7,10-11H2,1H3 |
| InChIKey | XVOVDMMXJXZAAR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |