C17H28N2O — CID 79560809
1-[2-[1-(azepan-2-yl)propan-2-ylamino]phenyl]ethanol (PubChem CID 79560809) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[2-[1-(azepan-2-yl)propan-2-ylamino]phenyl]ethanol.
| Compound Name | 1-[2-[1-(azepan-2-yl)propan-2-ylamino]phenyl]ethanol |
|---|---|
| PubChem CID | 79560809 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-[2-[1-(azepan-2-yl)propan-2-ylamino]phenyl]ethanol |
| SMILES | CC(CC1CCCCCN1)Nc1ccccc1C(C)O |
| InChI | InChI=1S/C17H28N2O/c1-13(12-15-8-4-3-7-11-18-15)19-17-10-6-5-9-16(17)14(2)20/h5-6,9-10,13-15,18-20H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | LUONATRYQRQNKL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |