C10H13BrN4S — CID 79542088
1-[(4-bromothiophen-2-yl)methyl]-5-propyltriazol-4-amine (PubChem CID 79542088) has the molecular formula C10H13BrN4S and a molecular weight of 301.21 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-5-propyltriazol-4-amine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-5-propyltriazol-4-amine |
|---|---|
| PubChem CID | 79542088 |
| Molecular Formula | C10H13BrN4S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-5-propyltriazol-4-amine |
| SMILES | CCCc1c(N)nnn1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H13BrN4S/c1-2-3-9-10(12)13-14-15(9)5-8-4-7(11)6-16-8/h4,6H,2-3,5,12H2,1H3 |
| InChIKey | NQNSUEXZYVSXID-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |