C12H21NO2S — CID 79552574
2-amino-4-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid (PubChem CID 79552574) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 2-amino-4-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 79552574 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-amino-4-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid |
| SMILES | NC(CCSCC1CC2CCC1C2)C(=O)O |
| InChI | InChI=1S/C12H21NO2S/c13-11(12(14)15)3-4-16-7-10-6-8-1-2-9(10)5-8/h8-11H,1-7,13H2,(H,14,15) |
| InChIKey | RCPPXXCXWBUWEW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|