C12H20O2S — CID 79553861
3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid (PubChem CID 79553861) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 79553861 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)butanoic acid |
| SMILES | CC(CC(=O)O)SCC1CC2CCC1C2 |
| InChI | InChI=1S/C12H20O2S/c1-8(4-12(13)14)15-7-11-6-9-2-3-10(11)5-9/h8-11H,2-7H2,1H3,(H,13,14) |
| InChIKey | ADOLKVSDOVKOAB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |