C14H21ClN2O3S — CID 79555531
2-[(3-chloro-2-methylpropyl)sulfonylamino]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 79555531) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylpropyl)sulfonylamino]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(3-chloro-2-methylpropyl)sulfonylamino]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 79555531 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[(3-chloro-2-methylpropyl)sulfonylamino]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNS(=O)(=O)CC(C)CCl)c1C |
| InChI | InChI=1S/C14H21ClN2O3S/c1-10(7-15)9-21(19,20)16-8-14(18)17-13-6-4-5-11(2)12(13)3/h4-6,10,16H,7-9H2,1-3H3,(H,17,18) |
| InChIKey | SPWCBUFWTTUJIF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|