C15H18FNO3S — CID 79556364
4-[4-fluoro-3-[(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]but-3-yn-1-ol (PubChem CID 79556364) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[4-fluoro-3-[(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-fluoro-3-[(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 79556364 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-[4-fluoro-3-[(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]but-3-yn-1-ol |
| SMILES | CC1CN(Cc2cc(C#CCCO)ccc2F)S(=O)(=O)C1 |
| InChI | InChI=1S/C15H18FNO3S/c1-12-9-17(21(19,20)11-12)10-14-8-13(4-2-3-7-18)5-6-15(14)16/h5-6,8,12,18H,3,7,9-11H2,1H3 |
| InChIKey | KIYBKPXWWXSZHZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|