C9H5Cl2N3O3 — CID 79557797
4-chloro-5-(2-chloro-6-nitrophenyl)-1,2-oxazol-3-amine (PubChem CID 79557797) has the molecular formula C9H5Cl2N3O3 and a molecular weight of 274.06 g/mol. Its IUPAC name is 4-chloro-5-(2-chloro-6-nitrophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-chloro-5-(2-chloro-6-nitrophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79557797 |
| Molecular Formula | C9H5Cl2N3O3 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 4-chloro-5-(2-chloro-6-nitrophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2c(Cl)cccc2[N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C9H5Cl2N3O3/c10-4-2-1-3-5(14(15)16)6(4)8-7(11)9(12)13-17-8/h1-3H,(H2,12,13) |
| InChIKey | DHSUBTWSMAXEMP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|