About 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol
2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol (PubChem CID 79564550) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol |
| PubChem CID | 79564550 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol |
| SMILES | CC1CN(CCC2CCCC2O)CCCO1 |
| InChI | InChI=1S/C13H25NO2/c1-11-10-14(7-3-9-16-11)8-6-12-4-2-5-13(12)15/h11-13,15H,2-10H2,1H3 |
| InChIKey | PFPIHCPUAJRATB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol?
The IUPAC name of 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol (CID 79564550) is 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol.
What is the SMILES notation for 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol?
The canonical SMILES for 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol is CC1CN(CCC2CCCC2O)CCCO1.
What is the InChIKey of 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol?
The InChIKey is PFPIHCPUAJRATB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-11-10-14(7-3-9-16-11)8-6-12-4-2-5-13(12)15/h11-13,15H,2-10H2,1H3.
What are the key properties of 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol?
2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol has a molecular weight of 227.35 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]cyclopentan-1-ol is sourced from PubChem (CID 79564550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).