C12H18N2O3 — CID 79569142
5,5-dimethyl-3-[2-(2-oxocyclopentyl)ethyl]imidazolidine-2,4-dione (PubChem CID 79569142) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(2-oxocyclopentyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-(2-oxocyclopentyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79569142 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5,5-dimethyl-3-[2-(2-oxocyclopentyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCC2CCCC2=O)C1=O |
| InChI | InChI=1S/C12H18N2O3/c1-12(2)10(16)14(11(17)13-12)7-6-8-4-3-5-9(8)15/h8H,3-7H2,1-2H3,(H,13,17) |
| InChIKey | VDZRSWXKACSQNS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|