C12H21N3O2 — CID 79572752
1-methyl-3-[2-[2-(methylamino)cyclopentyl]ethyl]imidazolidine-2,4-dione (PubChem CID 79572752) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-methyl-3-[2-[2-(methylamino)cyclopentyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[2-[2-(methylamino)cyclopentyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79572752 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-methyl-3-[2-[2-(methylamino)cyclopentyl]ethyl]imidazolidine-2,4-dione |
| SMILES | CNC1CCCC1CCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C12H21N3O2/c1-13-10-5-3-4-9(10)6-7-15-11(16)8-14(2)12(15)17/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | GMCLEWSQHKYATD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|