About 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine
1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine (PubChem CID 79579449) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine |
| PubChem CID | 79579449 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(C)C(CN)c1cnn(C)c1C |
| InChI | InChI=1S/C13H26N4/c1-6-11(7-2)16(4)13(8-14)12-9-15-17(5)10(12)3/h9,11,13H,6-8,14H2,1-5H3 |
| InChIKey | CTJUCAGNIYYICO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine?
The IUPAC name of 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine (CID 79579449) is 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine.
What is the SMILES notation for 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine?
The canonical SMILES for 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine is CCC(CC)N(C)C(CN)c1cnn(C)c1C.
What is the InChIKey of 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine?
The InChIKey is CTJUCAGNIYYICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4/c1-6-11(7-2)16(4)13(8-14)12-9-15-17(5)10(12)3/h9,11,13H,6-8,14H2,1-5H3.
What are the key properties of 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine?
1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine has a molecular weight of 238.38 g/mol, XLogP of 1.85, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethylpyrazol-4-yl)-N-methyl-N-pentan-3-ylethane-1,2-diamine is sourced from PubChem (CID 79579449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).