C9H17ClF3NO2S — CID 79585214
3-chloro-2-methyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 79585214) has the molecular formula C9H17ClF3NO2S and a molecular weight of 295.75 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 79585214 |
| Molecular Formula | C9H17ClF3NO2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-chloro-2-methyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H17ClF3NO2S/c1-7(2)14(6-9(11,12)13)17(15,16)5-8(3)4-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | CTBJUFCTZACSFH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|