C10H19ClF3NO2S — CID 54877244
3-chloro-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 54877244) has the molecular formula C10H19ClF3NO2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 3-chloro-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877244 |
| Molecular Formula | C10H19ClF3NO2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-chloro-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CCC(CC)N(CC(F)(F)F)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H19ClF3NO2S/c1-3-9(4-2)15(8-10(12,13)14)18(16,17)7-5-6-11/h9H,3-8H2,1-2H3 |
| InChIKey | OBDGUBMFPMCFKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|