C8H15ClF3NO2S — CID 60960122
3-chloro-N-propyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 60960122) has the molecular formula C8H15ClF3NO2S and a molecular weight of 281.73 g/mol. Its IUPAC name is 3-chloro-N-propyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-propyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60960122 |
| Molecular Formula | C8H15ClF3NO2S |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-chloro-N-propyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C8H15ClF3NO2S/c1-2-5-13(7-8(10,11)12)16(14,15)6-3-4-9/h2-7H2,1H3 |
| InChIKey | QZBMGVLUMIXLEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|