C15H24N2O2S2 — CID 79587926
ethyl 1-(ethylamino)-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylate (PubChem CID 79587926) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is ethyl 1-(ethylamino)-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(ethylamino)-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79587926 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 1-(ethylamino)-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylate |
| SMILES | CCNC1(C(=O)OCC)CCCC1CCSc1nccs1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-3-17-15(13(18)19-4-2)8-5-6-12(15)7-10-20-14-16-9-11-21-14/h9,11-12,17H,3-8,10H2,1-2H3 |
| InChIKey | ICGCSXYJVNQXGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|