C11H18N2OS2 — CID 79581805
[1-amino-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentyl]methanol (PubChem CID 79581805) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [1-amino-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentyl]methanol.
| Compound Name | [1-amino-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79581805 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [1-amino-2-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]cyclopentyl]methanol |
| SMILES | NC1(CO)CCCC1CCSc1nccs1 |
| InChI | InChI=1S/C11H18N2OS2/c12-11(8-14)4-1-2-9(11)3-6-15-10-13-5-7-16-10/h5,7,9,14H,1-4,6,8,12H2 |
| InChIKey | CSZTUWPCMWYJGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|