C14H19F2NO2 — CID 79581784
[1-amino-2-[2-(3,4-difluorophenoxy)ethyl]cyclopentyl]methanol (PubChem CID 79581784) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is [1-amino-2-[2-(3,4-difluorophenoxy)ethyl]cyclopentyl]methanol.
| Compound Name | [1-amino-2-[2-(3,4-difluorophenoxy)ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79581784 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [1-amino-2-[2-(3,4-difluorophenoxy)ethyl]cyclopentyl]methanol |
| SMILES | NC1(CO)CCCC1CCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c15-12-4-3-11(8-13(12)16)19-7-5-10-2-1-6-14(10,17)9-18/h3-4,8,10,18H,1-2,5-7,9,17H2 |
| InChIKey | ZBBSJNBQCMHSAE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |