C17H19N3S — CID 79610908
5-[[4-(pyrrolidin-1-ylmethyl)anilino]methyl]thiophene-3-carbonitrile (PubChem CID 79610908) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 5-[[4-(pyrrolidin-1-ylmethyl)anilino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[4-(pyrrolidin-1-ylmethyl)anilino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79610908 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-[[4-(pyrrolidin-1-ylmethyl)anilino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2ccc(CN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C17H19N3S/c18-10-15-9-17(21-13-15)11-19-16-5-3-14(4-6-16)12-20-7-1-2-8-20/h3-6,9,13,19H,1-2,7-8,11-12H2 |
| InChIKey | PWBNVCKABQZSTJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |