C13H21N3O4S — CID 79613124
methyl 2-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methyl]imidazole-4-carboxylate (PubChem CID 79613124) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is methyl 2-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methyl]imidazole-4-carboxylate.
| Compound Name | methyl 2-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 79613124 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 2-methyl-3-[(1-methylsulfonylpiperidin-3-yl)methyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cnc(C)n1CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H21N3O4S/c1-10-14-7-12(13(17)20-2)16(10)9-11-5-4-6-15(8-11)21(3,18)19/h7,11H,4-6,8-9H2,1-3H3 |
| InChIKey | RKQSWMQDNGKWQA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |