C14H26N4O2S — CID 79619913
N-[[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazol-4-yl]methyl]propan-2-amine (PubChem CID 79619913) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-[[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 79619913 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cnn(CC2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C14H26N4O2S/c1-12(2)15-7-14-8-16-17(10-14)9-13-5-4-6-18(11-13)21(3,19)20/h8,10,12-13,15H,4-7,9,11H2,1-3H3 |
| InChIKey | YJMQUMIYCWTXIJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |