C13H23N3O3S — CID 116805394
1-methylsulfonyl-3-[(1-propan-2-ylpyrazol-4-yl)oxymethyl]piperidine (PubChem CID 116805394) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-methylsulfonyl-3-[(1-propan-2-ylpyrazol-4-yl)oxymethyl]piperidine.
| Compound Name | 1-methylsulfonyl-3-[(1-propan-2-ylpyrazol-4-yl)oxymethyl]piperidine |
|---|---|
| PubChem CID | 116805394 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-methylsulfonyl-3-[(1-propan-2-ylpyrazol-4-yl)oxymethyl]piperidine |
| SMILES | CC(C)n1cc(OCC2CCCN(S(C)(=O)=O)C2)cn1 |
| InChI | InChI=1S/C13H23N3O3S/c1-11(2)16-9-13(7-14-16)19-10-12-5-4-6-15(8-12)20(3,17)18/h7,9,11-12H,4-6,8,10H2,1-3H3 |
| InChIKey | LYBOOUYYCUEMPH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |