C16H24BrNO2S — CID 79620394
3-[3-bromo-2-(4-methylphenyl)propyl]-1-methylsulfonylpiperidine (PubChem CID 79620394) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 3-[3-bromo-2-(4-methylphenyl)propyl]-1-methylsulfonylpiperidine.
| Compound Name | 3-[3-bromo-2-(4-methylphenyl)propyl]-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 79620394 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 3-[3-bromo-2-(4-methylphenyl)propyl]-1-methylsulfonylpiperidine |
| SMILES | Cc1ccc(C(CBr)CC2CCCN(S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C16H24BrNO2S/c1-13-5-7-15(8-6-13)16(11-17)10-14-4-3-9-18(12-14)21(2,19)20/h5-8,14,16H,3-4,9-12H2,1-2H3 |
| InChIKey | CXUCELBORUTFRD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|