C13H11Cl3N2S — CID 79625310
7-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 79625310) has the molecular formula C13H11Cl3N2S and a molecular weight of 333.67 g/mol. Its IUPAC name is 7-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 7-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79625310 |
| Molecular Formula | C13H11Cl3N2S |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 7-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)C(c1c(Cl)cc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C13H11Cl3N2S/c14-6-4-8(15)11(9(16)5-6)7-2-1-3-10-12(7)19-13(17)18-10/h4-5,7H,1-3H2,(H2,17,18) |
| InChIKey | WFHXWYFRKFYNIC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |