C13H11F3N2S — CID 79625621
7-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 79625621) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is 7-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 7-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79625621 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 7-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)C(c1cc(F)c(F)cc1F)CCC2 |
| InChI | InChI=1S/C13H11F3N2S/c14-8-5-10(16)9(15)4-7(8)6-2-1-3-11-12(6)19-13(17)18-11/h4-6H,1-3H2,(H2,17,18) |
| InChIKey | AMERCQWMHVSGCO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|