About 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid
3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid (PubChem CID 79628980) has the molecular formula C9H13NO5
and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 79628980 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1C(=O)COCC1=O)C(=O)O |
| InChI | InChI=1S/C9H13NO5/c1-9(2,8(13)14)5-10-6(11)3-15-4-7(10)12/h3-5H2,1-2H3,(H,13,14) |
| InChIKey | QRQWPJGLEIIIIA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid (CID 79628980) is 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid is CC(C)(CN1C(=O)COCC1=O)C(=O)O.
What is the InChIKey of 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid?
The InChIKey is QRQWPJGLEIIIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5/c1-9(2,8(13)14)5-10-6(11)3-15-4-7(10)12/h3-5H2,1-2H3,(H,13,14).
What are the key properties of 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid?
3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid has a molecular weight of 215.20 g/mol, XLogP of -0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79628980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).