C11H18N2O3S — CID 65260157
5-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpentanethioamide (PubChem CID 65260157) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 5-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpentanethioamide.
| Compound Name | 5-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 65260157 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-(3,5-dioxomorpholin-4-yl)-2,2-dimethylpentanethioamide |
| SMILES | CC(C)(CCCN1C(=O)COCC1=O)C(N)=S |
| InChI | InChI=1S/C11H18N2O3S/c1-11(2,10(12)17)4-3-5-13-8(14)6-16-7-9(13)15/h3-7H2,1-2H3,(H2,12,17) |
| InChIKey | XZVHQNMFNKVWJG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|