C10H18N2O3 — CID 58799780
4-[(2S)-2-amino-3,3-dimethylbutyl]morpholine-3,5-dione (PubChem CID 58799780) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3,3-dimethylbutyl]morpholine-3,5-dione.
| Compound Name | 4-[(2S)-2-amino-3,3-dimethylbutyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 58799780 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-[(2S)-2-amino-3,3-dimethylbutyl]morpholine-3,5-dione |
| SMILES | CC(C)(C)[C@H](N)CN1C(=O)COCC1=O |
| InChI | InChI=1S/C10H18N2O3/c1-10(2,3)7(11)4-12-8(13)5-15-6-9(12)14/h7H,4-6,11H2,1-3H3/t7-/m1/s1 |
| InChIKey | DSAYKANOFDVAEM-SSDOTTSWSA-N |
| XLogP | -0.25 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|