C18H22N2O4S2 — CID 7963053
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 7963053) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963053 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | O=C1CN(C(=O)COC(=O)CCCC[C@H]2CCSS2)c2ccccc2N1 |
| InChI | InChI=1S/C18H22N2O4S2/c21-16-11-20(15-7-3-2-6-14(15)19-16)17(22)12-24-18(23)8-4-1-5-13-9-10-25-26-13/h2-3,6-7,13H,1,4-5,8-12H2,(H,19,21)/t13-/m0/s1 |
| InChIKey | DSZOHWISOYSNBQ-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|