C15H30N2O4 — CID 79647195
ethyl 3-[bis(2-methoxyethyl)amino]-1-(methylamino)cyclopentane-1-carboxylate (PubChem CID 79647195) has the molecular formula C15H30N2O4 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethyl 3-[bis(2-methoxyethyl)amino]-1-(methylamino)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-[bis(2-methoxyethyl)amino]-1-(methylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79647195 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | ethyl 3-[bis(2-methoxyethyl)amino]-1-(methylamino)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC)CCC(N(CCOC)CCOC)C1 |
| InChI | InChI=1S/C15H30N2O4/c1-5-21-14(18)15(16-2)7-6-13(12-15)17(8-10-19-3)9-11-20-4/h13,16H,5-12H2,1-4H3 |
| InChIKey | VKMICWFSLHORQI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |