C15H30N2O2 — CID 79655405
ethyl 1-(methylamino)-3-[methyl(3-methylbutan-2-yl)amino]cyclopentane-1-carboxylate (PubChem CID 79655405) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is ethyl 1-(methylamino)-3-[methyl(3-methylbutan-2-yl)amino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(methylamino)-3-[methyl(3-methylbutan-2-yl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79655405 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | ethyl 1-(methylamino)-3-[methyl(3-methylbutan-2-yl)amino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC)CCC(N(C)C(C)C(C)C)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-7-19-14(18)15(16-5)9-8-13(10-15)17(6)12(4)11(2)3/h11-13,16H,7-10H2,1-6H3 |
| InChIKey | FTGHCJALBOAQNH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |