C13H26N2O2 — CID 79649954
ethyl 1-(methylamino)-3-[methyl(propyl)amino]cyclopentane-1-carboxylate (PubChem CID 79649954) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethyl 1-(methylamino)-3-[methyl(propyl)amino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(methylamino)-3-[methyl(propyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79649954 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethyl 1-(methylamino)-3-[methyl(propyl)amino]cyclopentane-1-carboxylate |
| SMILES | CCCN(C)C1CCC(NC)(C(=O)OCC)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-5-9-15(4)11-7-8-13(10-11,14-3)12(16)17-6-2/h11,14H,5-10H2,1-4H3 |
| InChIKey | FPCMSMPDUVCVBI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |