C16H26N2S — CID 79650149
1-(cyclopropylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carbonitrile (PubChem CID 79650149) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carbonitrile.
| Compound Name | 1-(cyclopropylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79650149 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(cyclopropylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carbonitrile |
| SMILES | CC1CCCC(SC2CCC(C#N)(NC3CC3)C2)C1 |
| InChI | InChI=1S/C16H26N2S/c1-12-3-2-4-14(9-12)19-15-7-8-16(10-15,11-17)18-13-5-6-13/h12-15,18H,2-10H2,1H3 |
| InChIKey | JYGFRWBMINNKHH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |