C13H20FN3O3 — CID 79653230
N'-(4-fluoro-5-methoxy-2-nitrophenyl)-N',2,2-trimethylpropane-1,3-diamine (PubChem CID 79653230) has the molecular formula C13H20FN3O3 and a molecular weight of 285.32 g/mol. Its IUPAC name is N'-(4-fluoro-5-methoxy-2-nitrophenyl)-N',2,2-trimethylpropane-1,3-diamine.
| Compound Name | N'-(4-fluoro-5-methoxy-2-nitrophenyl)-N',2,2-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79653230 |
| Molecular Formula | C13H20FN3O3 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N'-(4-fluoro-5-methoxy-2-nitrophenyl)-N',2,2-trimethylpropane-1,3-diamine |
| SMILES | COc1cc(N(C)CC(C)(C)CN)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H20FN3O3/c1-13(2,7-15)8-16(3)10-6-12(20-4)9(14)5-11(10)17(18)19/h5-6H,7-8,15H2,1-4H3 |
| InChIKey | UDYTWJZLPXRERP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|